EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20ClNO2 |
| Net Charge | 0 |
| Average Mass | 293.794 |
| Monoisotopic Mass | 293.11826 |
| SMILES | [H][C@@]12CC[C@@]([H])(N1C)[C@@]([H])(C(=O)OC)[C@@]([H])(c1ccc(Cl)cc1)C2 |
| InChI | InChI=1S/C16H20ClNO2/c1-18-12-7-8-14(18)15(16(19)20-2)13(9-12)10-3-5-11(17)6-4-10/h3-6,12-15H,7-9H2,1-2H3/t12-,13+,14+,15-/m0/s1 |
| InChIKey | ZEOHVQFWFVMPGM-YJNKXOJESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Application: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RTI-31 (CHEBI:232619) has role dopamine uptake inhibitor (CHEBI:51039) |
| RTI-31 (CHEBI:232619) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| methyl (1R,2S,3S,5S)-3-(4-chlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate |
| Synonyms | Source |
|---|---|
| Rti-COC 31 | SUBMITTER |
| 3β-(4-chorophenyl)tropane-2β-carboxylic acid methyl ester tartrate | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| https://en.wikipedia.org/wiki/RTI-31 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:130342-80-2 | SUBMITTER |
| Citations |
|---|