EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H25F2N3O6 |
| Net Charge | 0 |
| Average Mass | 513.497 |
| Monoisotopic Mass | 513.17114 |
| SMILES | [H][C@@](CC(=O)O)(/N=C(\O)[C@@]([H])(NC(=O)c1ccc2ccccc2n1)C(C)C)C(=O)COc1c(F)cccc1F |
| InChI | InChI=1S/C26H25F2N3O6/c1-14(2)23(31-25(35)19-11-10-15-6-3-4-9-18(15)29-19)26(36)30-20(12-22(33)34)21(32)13-37-24-16(27)7-5-8-17(24)28/h3-11,14,20,23H,12-13H2,1-2H3,(H,30,36)(H,31,35)(H,33,34)/t20-,23-/m0/s1 |
| InChIKey | OOBJCYKITXPCNS-REWPJTCUSA-N |
| Roles Classification |
|---|
| Biological Role: | apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Q-VD-OPh hydrate (CHEBI:232611) has role apoptosis inhibitor (CHEBI:68494) |
| Q-VD-OPh hydrate (CHEBI:232611) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| quinoline-Val-Asp-difluorophenoxymethylketone | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:1135695-98-5 | SUBMITTER |
| Citations |
|---|