EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16F3N3O2S |
| Net Charge | 0 |
| Average Mass | 395.406 |
| Monoisotopic Mass | 395.09153 |
| SMILES | Cc1ccc(C)c(-c2cc(C(F)(F)F)nn2-c2ccc(S(N)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C18H16F3N3O2S/c1-11-3-4-12(2)15(9-11)16-10-17(18(19,20)21)23-24(16)13-5-7-14(8-6-13)27(22,25)26/h3-10H,1-2H3,(H2,22,25,26) |
| InChIKey | NTFOSUUWGCDXEF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,5-dimethylcelecoxib (CHEBI:232608) has role geroprotector (CHEBI:176497) |
| 2,5-dimethylcelecoxib (CHEBI:232608) is a organic molecular entity (CHEBI:50860) |
| Manual Xrefs | Databases |
|---|---|
| HMDB0245502 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:457639-26-8 | SUBMITTER |
| Citations |
|---|