EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:232592 - CB-103
| Formula | C15H18N2O |
| Net Charge | 0 |
| Average Mass | 242.322 |
| Monoisotopic Mass | 242.14191 |
| SMILES | CC(C)(C)c1ccc(Oc2ccc(N)cn2)cc1 |
| InChI | InChI=1S/C15H18N2O/c1-15(2,3)11-4-7-13(8-5-11)18-14-9-6-12(16)10-17-14/h4-10H,16H2,1-3H3 |
| InChIKey | WHIWGRCYMQLLAO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CB-103 (CHEBI:232592) has role antineoplastic agent (CHEBI:35610) |
| CB-103 (CHEBI:232592) has role inhibitor (CHEBI:35222) |
| CB-103 (CHEBI:232592) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| Limantrafin | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:218457-67-1 | SUBMITTER |
| Citations |
|---|