EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H41N5O3 |
| Net Charge | 0 |
| Average Mass | 435.613 |
| Monoisotopic Mass | 435.32094 |
| SMILES | [H][C@@](Cc1ccc(O)cc1)(/N=C(\O)CCC)/C(O)=N/CCCCNCCCNCCCN |
| InChI | InChI=1S/C23H41N5O3/c1-2-7-22(30)28-21(18-19-8-10-20(29)11-9-19)23(31)27-17-4-3-13-25-15-6-16-26-14-5-12-24/h8-11,21,25-26,29H,2-7,12-18,24H2,1H3,(H,27,31)(H,28,30)/t21-/m0/s1 |
| InChIKey | VRQNABCCOFCGJL-NRFANRHFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Philanthus triangulum (ncbitaxon:280486) | - | PubMed (31244109) |
| Roles Classification |
|---|
| Biological Role: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| Application: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| philanthotoxin 433 (CHEBI:232580) has role nicotinic antagonist (CHEBI:48878) |
| philanthotoxin 433 (CHEBI:232580) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| philanthotoxin-433 | SUBMITTER |
| PhTX 433 | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:115976-91-5 | SUBMITTER |
| Citations |
|---|