EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N6O2 |
| Net Charge | 0 |
| Average Mass | 446.555 |
| Monoisotopic Mass | 446.24302 |
| SMILES | COc1cc(OC)cc(N(CCNC(C)C)c2ccc3ncc(-c4cnn(C)c4)nc3c2)c1 |
| InChI | InChI=1S/C25H30N6O2/c1-17(2)26-8-9-31(20-10-21(32-4)13-22(11-20)33-5)19-6-7-23-24(12-19)29-25(15-27-23)18-14-28-30(3)16-18/h6-7,10-17,26H,8-9H2,1-5H3 |
| InChIKey | OLAHOMJCDNXHFI-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Erdafitinib (CHEBI:232556) has role antineoplastic agent (CHEBI:35610) |
| Erdafitinib (CHEBI:232556) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| Erdafitinib | ChEMBL |
| JNJ-42756493 | ChEMBL |
| N'-(3,5-dimethoxyphenyl)-N'-[3-(1-methylpyrazol-4-yl)quinoxalin-6-yl]-N-propan-2-ylethane-1,2-diamine | SUBMITTER |
| Brand Name | Source |
|---|---|
| Balversa | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:1346242-81-6 | SUBMITTER |
| Citations |
|---|