EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H35N5.2Cl.Mn |
| Net Charge | 0 |
| Average Mass | 483.390 |
| Monoisotopic Mass | 482.16500 |
| SMILES | [Cl-].[Cl-].[H][C@@]12CCCC[C@@]1([H])NCc1cccc(n1)CN[C@]1([H])CCCC[C@@]1([H])NCCN2.[Mn+2] |
| InChI | InChI=1S/C21H35N5.2ClH.Mn/c1-3-10-20-18(8-1)22-12-13-23-19-9-2-4-11-21(19)25-15-17-7-5-6-16(26-17)14-24-20;;;/h5-7,18-25H,1-4,8-15H2;2*1H;/q;;;+2/p-2/t18-,19-,20-,21-;;;/m1.../s1 |
| InChIKey | WXEMWBBXVXHEPU-XNPJUPKFSA-L |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Application: | enzyme mimic Any small molecule that mimics the action of an enzyme. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imisopasem manganese (CHEBI:232553) has role enzyme mimic (CHEBI:78152) |
| imisopasem manganese (CHEBI:232553) has role radical scavenger (CHEBI:48578) |
| imisopasem manganese (CHEBI:232553) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| M40403 | SUBMITTER |
| Unii-2Q6R3259KS | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| D06607 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:218791-21-0 | SUBMITTER |