EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H29NO11.HCl |
| Net Charge | 0 |
| Average Mass | 579.986 |
| Monoisotopic Mass | 579.15074 |
| SMILES | Cl.[H][C@]1(O[C@@]2([H])C[C@](O)(C(=O)CO)Cc3c(O)c4c(c(O)c32)C(=O)c2c(OC)cccc2C4=O)C[C@]([H])(N)[C@@]([H])(O)[C@]([H])(C)O1 |
| InChI | InChI=1S/C27H29NO11.ClH/c1-10-22(31)13(28)6-17(38-10)39-15-8-27(36,16(30)9-29)7-12-19(15)26(35)21-20(24(12)33)23(32)11-4-3-5-14(37-2)18(11)25(21)34;/h3-5,10,13,15,17,22,29,31,33,35-36H,6-9,28H2,1-2H3;1H/t10-,13-,15-,17-,22-,27-;/m0./s1 |
| InChIKey | MWWSFMDVAYGXBV-FGBSZODSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| epirubicin hydrochloride (CHEBI:232543) has role antineoplastic agent (CHEBI:35610) |
| epirubicin hydrochloride (CHEBI:232543) is a anthracycline (CHEBI:48120) |
| Manual Xrefs | Databases |
|---|---|
| D02214 | KEGG DRUG |
| Registry Numbers | Sources |
|---|---|
| CAS:56390-09-1 | SUBMITTER |