EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C64H76N8O4.5Cl.Mn |
| Net Charge | 0 |
| Average Mass | 1253.567 |
| Monoisotopic Mass | 1250.38126 |
| SMILES | CCCCOCCN1C=CC=C/C1=C1/C2=N/C(=C(/c3cccc[n+]3CCOCCCC)C3=N/C(=C(/c4cccc[n+]4CCOCCCC)c4ccc([n-]4)/C(c4cccc[n+]4CCOCCCC)=C4/C=CC1=N4)C=C3)C=C2.[Cl-].[Cl-].[Cl-].[Cl-].[Cl-].[Mn+3] |
| InChI | InChI=1S/C64H76N8O4.5ClH.Mn/c1-5-9-41-73-45-37-69-33-17-13-21-57(69)61-49-25-27-51(65-49)62(58-22-14-18-34-70(58)38-46-74-42-10-6-2)53-29-31-55(67-53)64(60-24-16-20-36-72(60)40-48-76-44-12-8-4)56-32-30-54(68-56)63(52-28-26-50(61)66-52)59-23-15-19-35-71(59)39-47-75-43-11-7-3;;;;;;/h13-36H,5-12,37-48H2,1-4H3;5*1H;/q+2;;;;;;+3/p-5 |
| InChIKey | FVIXMTYHFFAYDY-UHFFFAOYSA-I |
| Roles Classification |
|---|
| Applications: | radiation protective agent Any compound that is able to protect normal cells from the damage caused by radiation therapy. enzyme mimic Any small molecule that mimics the action of an enzyme. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| BMX-001 (CHEBI:232540) has role enzyme mimic (CHEBI:78152) |
| BMX-001 (CHEBI:232540) has role radiation protective agent (CHEBI:66987) |
| BMX-001 (CHEBI:232540) is a organic molecular entity (CHEBI:50860) |
| Registry Numbers | Sources |
|---|---|
| CAS:1379783-91-1 | SUBMITTER |
| Citations |
|---|