EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H20FNO2 |
| Net Charge | 0 |
| Average Mass | 277.339 |
| Monoisotopic Mass | 277.14781 |
| SMILES | [H][C@@]12CC[C@@]([H])(N1C)[C@@]([H])(C(=O)OC)[C@@]([H])(c1ccc(F)cc1)C2 |
| InChI | InChI=1S/C16H20FNO2/c1-18-12-7-8-14(18)15(16(19)20-2)13(9-12)10-3-5-11(17)6-4-10/h3-6,12-15H,7-9H2,1-2H3/t12-,13+,14+,15-/m0/s1 |
| InChIKey | QUSLQENMLDRCTO-YJNKXOJESA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| Application: | dopamine uptake inhibitor A dopaminergic agent that blocks the transport of dopamine into axon terminals or into storage vesicles within terminals. Most of the adrenergic uptake inhibitors also inhibit dopamine uptake. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| WIN-35428 (CHEBI:232539) has role dopamine uptake inhibitor (CHEBI:51039) |
| WIN-35428 (CHEBI:232539) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| β-CFT | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| https://en.wikipedia.org/wiki/WIN-35428 | Wikipedia |
| Citations |
|---|