EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:232536 - P-CH-clothianidin
| Formula | C9H11ClN4O2 |
| Net Charge | 0 |
| Average Mass | 242.666 |
| Monoisotopic Mass | 242.05705 |
| SMILES | CN/C(=C/N(=O)=O)NCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C9H11ClN4O2/c1-11-9(6-14(15)16)13-5-7-2-3-8(10)12-4-7/h2-4,6,11,13H,5H2,1H3/b9-6- |
| InChIKey | HVEUAXZJMGUHAT-TWGQIWQCSA-N |
| Roles Classification |
|---|
| Biological Role: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| Application: | neonicotinoid insectide A class of neuro-active insecticides that act at the nicotinic acetylcholine receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| P-CH-clothianidin (CHEBI:232536) has role neonicotinoid insectide (CHEBI:25540) |
| P-CH-clothianidin (CHEBI:232536) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (Z)-1-N'-[(6-chloropyridin-3-yl)methyl]-1-N-methyl-2-nitroethene-1,1-diamine |
| Citations |
|---|