EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H20O2 |
| Net Charge | 0 |
| Average Mass | 196.290 |
| Monoisotopic Mass | 196.14633 |
| SMILES | CC(=O)OC1CC2CCC1(C)C2(C)C |
| InChI | InChI=1S/C12H20O2/c1-8(13)14-10-7-9-5-6-12(10,4)11(9,2)3/h9-10H,5-7H2,1-4H3 |
| InChIKey | KGEKLUUHTZCSIP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | flavouring agent A food additive that is used to added improve the taste or odour of a food. |
| Applications: | flavouring agent A food additive that is used to added improve the taste or odour of a food. fragrance A substance, extract, or preparation for diffusing or imparting an agreeable or attractive smell. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bornyl acetate (CHEBI:232534) has role flavouring agent (CHEBI:35617) |
| bornyl acetate (CHEBI:232534) has role fragrance (CHEBI:48318) |
| bornyl acetate (CHEBI:232534) is a organic molecular entity (CHEBI:50860) |
| Manual Xrefs | Databases |
|---|---|
| https://en.wikipedia.org/wiki/Bornyl_acetate | Wikipedia |