EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21F3N6 |
| Net Charge | 0 |
| Average Mass | 390.413 |
| Monoisotopic Mass | 390.17798 |
| SMILES | CCc1cncnc1N1CCN(Cc2nc3ccc(C(F)(F)F)cc3n2)CC1 |
| InChI | InChI=1S/C19H21F3N6/c1-2-13-10-23-12-24-18(13)28-7-5-27(6-8-28)11-17-25-15-4-3-14(19(20,21)22)9-16(15)26-17/h3-4,9-10,12H,2,5-8,11H2,1H3,(H,25,26) |
| InChIKey | FBLPQCAQRNSVHB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| PF-4708671 (CHEBI:232526) has role inhibitor (CHEBI:35222) |
| PF-4708671 (CHEBI:232526) is a organic molecular entity (CHEBI:50860) |
| Synonym | Source |
|---|---|
| 2-[[4-(5-ethylpyrimidin-4-yl)piperazin-1-yl]methyl]-6-(trifluoromethyl)-1H-benzimidazole | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:1255517-76-0 | SUBMITTER |
| Citations |
|---|