EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H23N5O2 |
| Net Charge | 0 |
| Average Mass | 413.481 |
| Monoisotopic Mass | 413.18517 |
| SMILES | Cc1cc2c(C(=N)O)cccc2n1-c1nc2c(/c(=N/Cc3ccccc3)n1)COCC2 |
| InChI | InChI=1S/C24H23N5O2/c1-15-12-18-17(22(25)30)8-5-9-21(18)29(15)24-27-20-10-11-31-14-19(20)23(28-24)26-13-16-6-3-2-4-7-16/h2-9,12H,10-11,13-14H2,1H3,(H2,25,30)(H,26,27,28) |
| InChIKey | RDALZZCKQFLGJP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CB-5083 (CHEBI:232521) has role inhibitor (CHEBI:35222) |
| CB-5083 (CHEBI:232521) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 1-[4-(benzylamino)-7,8-dihydro-5H-pyrano[4,3-d]pyrimidin-2-yl]-2-methylindole-4-carboxamide |
| Registry Numbers | Sources |
|---|---|
| CAS:1542705-92-9 | SUBMITTER |