EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H38BrF3N4O |
| Net Charge | 0 |
| Average Mass | 691.636 |
| Monoisotopic Mass | 690.21811 |
| SMILES | O/C(=N\C1(c2ccccc2)CC1)c1c(CN2CCC(N3CCCCC3)CC2)c(-c2cccc(C(F)(F)F)c2)nc2cc(Br)ccc12 |
| InChI | InChI=1S/C37H38BrF3N4O/c38-28-12-13-30-32(23-28)42-34(25-8-7-11-27(22-25)37(39,40)41)31(24-44-20-14-29(15-21-44)45-18-5-2-6-19-45)33(30)35(46)43-36(16-17-36)26-9-3-1-4-10-26/h1,3-4,7-13,22-23,29H,2,5-6,14-21,24H2,(H,43,46) |
| InChIKey | UIVOZBSCHXCGPS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antagonist Substance that attaches to and blocks cell receptors that normally bind naturally occurring substances. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GSK2193874 (CHEBI:232516) has role antagonist (CHEBI:48706) |
| GSK2193874 (CHEBI:232516) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 7-bromo-N-(1-phenylcyclopropyl)-3-[(4-piperidin-1-ylpiperidin-1-yl)methyl]-2-[3-(trifluoromethyl)phenyl]quinoline-4-carboxamide |
| Citations |
|---|