EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H23N5O2 |
| Net Charge | 0 |
| Average Mass | 401.470 |
| Monoisotopic Mass | 401.18517 |
| SMILES | CCN(Cc1ccccc1)C(=O)Cn1c(=O)n(C)c2cnc(-c3ccccc3)nc21 |
| InChI | InChI=1S/C23H23N5O2/c1-3-27(15-17-10-6-4-7-11-17)20(29)16-28-22-19(26(2)23(28)30)14-24-21(25-22)18-12-8-5-9-13-18/h4-14H,3,15-16H2,1-2H3 |
| InChIKey | NBMBIEOUVBHEBM-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Application: | anxiolytic drug Anxiolytic drugs are agents that alleviate anxiety, tension, and anxiety disorders, promote sedation, and have a calming effect without affecting clarity of consciousness or neurologic conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Emapunil (CHEBI:232500) has role anxiolytic drug (CHEBI:35474) |
| Emapunil (CHEBI:232500) is a organic molecular entity (CHEBI:50860) |
| Manual Xrefs | Databases |
|---|---|
| HMDB0251766 | HMDB |
| https://en.wikipedia.org/wiki/Emapunil | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:226954-04-7 | SUBMITTER |