EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H21FN2O |
| Net Charge | 0 |
| Average Mass | 300.377 |
| Monoisotopic Mass | 300.16379 |
| SMILES | Cc1cc(C(=O)CN2CCCC2)c(C)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H21FN2O/c1-13-11-17(18(22)12-20-9-3-4-10-20)14(2)21(13)16-7-5-15(19)6-8-16/h5-8,11H,3-4,9-10,12H2,1-2H3 |
| InChIKey | JUWDSDKJBMFLHE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.19.* (omega-peptidase) inhibitor Any EC 3.4.* (hydrolases acting on peptide bond) inhibitor that interferes with the action of any omega-peptidase (EC 3.4.19.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| IU1 (CHEBI:232499) has role EC 3.4.19.* (omega-peptidase) inhibitor (CHEBI:77705) |
| IU1 (CHEBI:232499) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| 1-[1-(4-fluorophenyl)-2,5-dimethylpyrrol-3-yl]-2-pyrrolidin-1-ylethanone |
| Registry Numbers | Sources |
|---|---|
| CAS:314245-33-5 | SUBMITTER |