EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H20N2O3.C2H6 |
| Net Charge | 0 |
| Average Mass | 426.516 |
| Monoisotopic Mass | 426.19434 |
| SMILES | CC.[H]/C(C(=O)c1cccc(-n2cc(-c3ccc(C)cc3)nc2O)c1)=C(/[H])c1cccc(O)c1 |
| InChI | InChI=1S/C25H20N2O3.C2H6/c1-17-8-11-19(12-9-17)23-16-27(25(30)26-23)21-6-3-5-20(15-21)24(29)13-10-18-4-2-7-22(28)14-18;1-2/h2-16,28H,1H3,(H,26,30);1-2H3/b13-10+; |
| InChIKey | SWEWJRLTDBLISN-RSGUCCNWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Casiopeina II-gly (CHEBI:232493) has role antineoplastic agent (CHEBI:35610) |
| Casiopeina II-gly (CHEBI:232493) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| ethane;3-[3-[(E)-3-(3-hydroxyphenyl)prop-2-enoyl]phenyl]-5-(4-methylphenyl)-1H-imidazol-2-one |
| Citations |
|---|