EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:232487 - 3,5-dithiocyanatopyridine-2,6-diamine
| Formula | C7H5N5S2 |
| Net Charge | 0 |
| Average Mass | 223.286 |
| Monoisotopic Mass | 222.99864 |
| SMILES | N#CSc1cc(SC#N)c(=N)nc1N |
| InChI | InChI=1S/C7H5N5S2/c8-2-13-4-1-5(14-3-9)7(11)12-6(4)10/h1H,(H4,10,11,12) |
| InChIKey | ZXOBLNBVNROVLC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.19.* (omega-peptidase) inhibitor Any EC 3.4.* (hydrolases acting on peptide bond) inhibitor that interferes with the action of any omega-peptidase (EC 3.4.19.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,5-dithiocyanatopyridine-2,6-diamine (CHEBI:232487) has role EC 3.4.19.* (omega-peptidase) inhibitor (CHEBI:77705) |
| 3,5-dithiocyanatopyridine-2,6-diamine (CHEBI:232487) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| (2,6-diamino-5-thiocyanatopyridin-3-yl) thiocyanate |
| Synonyms | Source |
|---|---|
| 2,6-Diaminopyridine-3,5-diyl bis(thiocyanate) | SUBMITTER |
| PR-619 | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:2645-32-1 | SUBMITTER |