EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O3 |
| Net Charge | 0 |
| Average Mass | 456.711 |
| Monoisotopic Mass | 456.36035 |
| SMILES | [H][C@@]12C(=O)C[C@H](C(C)C)[C@@]1(C)CC[C@]1(C)C3=C(CC[C@@]21C)[C@@]1(C)C[C@@H](O)[C@H](O)C(C)(C)[C@]1([H])CC3 |
| InChI | InChI=1S/C30H48O3/c1-17(2)20-15-21(31)24-27(20,5)13-14-29(7)19-9-10-23-26(3,4)25(33)22(32)16-28(23,6)18(19)11-12-30(24,29)8/h17,20,22-25,32-33H,9-16H2,1-8H3/t20-,22-,23+,24-,25+,27-,28-,29-,30+/m1/s1 |
| InChIKey | LZDDGYHUNCWDEN-LQRXHHGVSA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2α-hydroxyismotiol-19-one (CHEBI:232483) has role fungal metabolite (CHEBI:76946) |
| 2α-hydroxyismotiol-19-one (CHEBI:232483) is a triterpenoid (CHEBI:36615) |
| UniProt Name | Source |
|---|---|
| 2α-hydroxyismotiol-19-one | UniProt |
| Citations |
|---|