EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H52O3 |
| Net Charge | 0 |
| Average Mass | 484.765 |
| Monoisotopic Mass | 484.39165 |
| SMILES | [H][C@@]12CC[C@H](C(C)C)[C@@]1(C)CC[C@]1(C)C3=C(CC[C@@]21C)[C@@]1(C)C[C@@H](OC(C)=O)[C@H](O)C(C)(C)[C@]1([H])CC3 |
| InChI | InChI=1S/C32H52O3/c1-19(2)21-10-13-26-29(21,6)16-17-31(8)23-11-12-25-28(4,5)27(34)24(35-20(3)33)18-30(25,7)22(23)14-15-32(26,31)9/h19,21,24-27,34H,10-18H2,1-9H3/t21-,24-,25+,26-,27+,29-,30-,31-,32+/m1/s1 |
| InChIKey | NDHOYPXYLNBEOP-DOPOZWGESA-N |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2α-acetoxyisomotiol (CHEBI:232473) has role fungal metabolite (CHEBI:76946) |
| 2α-acetoxyisomotiol (CHEBI:232473) is a triterpenoid (CHEBI:36615) |
| Synonym | Source |
|---|---|
| 2α-O-acetylisomotiol | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 2α-acetoxyisomotiol | UniProt |
| Citations |
|---|