EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:232435 - pentachloroanisole
| Formula | C7H3Cl5O |
| Net Charge | 0 |
| Average Mass | 280.365 |
| Monoisotopic Mass | 277.86265 |
| SMILES | COc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C7H3Cl5O/c1-13-7-5(11)3(9)2(8)4(10)6(7)12/h1H3 |
| InChIKey | BBABSCYTNHOKOG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pentachloroanisole (CHEBI:232435) is a anisole (CHEBI:16579) |
| Manual Xrefs | Databases |
|---|---|
| HMDB0256245 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1825-21-4 | SUBMITTER |