EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20F3N3O |
| Net Charge | 0 |
| Average Mass | 363.383 |
| Monoisotopic Mass | 363.15585 |
| SMILES | O=C(Cn1nc(C(F)(F)F)c2c1CCCC2)N1CCCc2ccccc21 |
| InChI | InChI=1S/C19H20F3N3O/c20-19(21,22)18-14-8-2-4-10-16(14)25(23-18)12-17(26)24-11-5-7-13-6-1-3-9-15(13)24/h1,3,6,9H,2,4-5,7-8,10-12H2 |
| InChIKey | DLAGRCZUELSZFG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | potassium channel blocker An agent that inhibits cell membrane glycoproteins that are selectively permeable to potassium ions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| VU041 (CHEBI:232413) has role potassium channel blocker (CHEBI:50509) |
| VU041 (CHEBI:232413) is a organofluorine compound (CHEBI:37143) |
| VU041 (CHEBI:232413) is a quinolines (CHEBI:26513) |
| VU041 (CHEBI:232413) is a tertiary carboxamide (CHEBI:140326) |
| IUPAC Name |
|---|
| 1-(3,4-dihydroquinolin-1(2H)-yl)-2-[3-(trifluoromethyl)-4,5,6,7-tetrahydro-1H-indazol-1-yl]ethanone |
| Citations |
|---|