EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H27F3N2O4S.2HCl |
| Net Charge | 0 |
| Average Mass | 581.484 |
| Monoisotopic Mass | 580.11772 |
| SMILES | Cl.Cl.O=c1cc(CN2CCOCC2)occ1OCCCCCSc1ccnc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C25H27F3N2O4S.2ClH/c26-25(27,28)18-4-5-20-21(14-18)29-7-6-24(20)35-13-3-1-2-10-33-23-17-34-19(15-22(23)31)16-30-8-11-32-12-9-30;;/h4-7,14-15,17H,1-3,8-13,16H2;2*1H |
| InChIKey | LSECOAJFCKFQJG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.6.5.* (hydrolases acting on GTP; involved in cellular and subcellular movement) inhibitor Any EC 3.6.* (hydrolases acting on acid anhydrides) inhibitor that interferes with the action of any such enzyme acting on GTP that is involved in cellular and subcellular movement (EC 3.6.5.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| EHT 1864 (CHEBI:232411) has role EC 3.6.5.* (hydrolases acting on GTP; involved in cellular and subcellular movement) inhibitor (CHEBI:132771) |
| EHT 1864 (CHEBI:232411) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-(morpholin-4-ylmethyl)-5-[5-[7-(trifluoromethyl)quinolin-4-yl]sulfanylpentoxy]pyran-4-one;dihydrochloride |
| Synonym | Source |
|---|---|
| 5-(5-(7-(Trifluoromethyl)quinolin-4-ylthio)pentyloxy)-2-(morpholinomethyl)-4H-pyran-4-one dihydrochloride | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:754240-09-0 | SUBMITTER |
| Citations |
|---|