EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34N4O2.C4H4O4 |
| Net Charge | 0 |
| Average Mass | 538.645 |
| Monoisotopic Mass | 538.27913 |
| SMILES | COc1ccccc1N1CCN(CCN(C(=O)C2CCCCC2)c2ccccn2)CC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C25H34N4O2.C4H4O4/c1-31-23-12-6-5-11-22(23)28-18-15-27(16-19-28)17-20-29(24-13-7-8-14-26-24)25(30)21-9-3-2-4-10-21;5-3(6)1-2-4(7)8/h5-8,11-14,21H,2-4,9-10,15-20H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | XIGAHNVCEFUYOV-BTJKTKAUSA-N |
| Roles Classification |
|---|
| Biological Role: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| Application: | serotonergic antagonist Drugs that bind to but do not activate serotonin receptors, thereby blocking the actions of serotonin or serotonergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| WAY-100635 maleate (CHEBI:232409) has role serotonergic antagonist (CHEBI:48279) |
| WAY-100635 maleate (CHEBI:232409) is a maleate salt (CHEBI:50221) |
| Synonym | Source |
|---|---|
| WAY100635 | SUBMITTER |
| Citations |
|---|