EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13NO3 |
| Net Charge | 0 |
| Average Mass | 195.218 |
| Monoisotopic Mass | 195.08954 |
| SMILES | CC(N)(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C10H13NO3/c1-10(11,9(13)14)6-7-2-4-8(12)5-3-7/h2-5,12H,6,11H2,1H3,(H,13,14) |
| InChIKey | NHTGHBARYWONDQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor An EC 1.14.16.* (oxidoreductase acting on paired donors, reduced pteridine as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosine 3-monooxygenase (EC 1.14.16.2). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| racemetirosine (CHEBI:232408) has role antineoplastic agent (CHEBI:35610) |
| racemetirosine (CHEBI:232408) has role EC 1.14.16.2 (tyrosine 3-monooxygenase) inhibitor (CHEBI:63932) |
| racemetirosine (CHEBI:232408) is a racemate (CHEBI:60911) |
| INNs | Source |
|---|---|
| racemetirosina | WHO MedNet |
| racemetirosine | WHO MedNet |
| Synonyms | Source |
|---|---|
| .alpha.-methyl-p-tyrosine | ChEMBL |
| alpha-methyl-p-tyrosine | SUBMITTER |
| .alpha.-methyltyrosine | ChEMBL |
| Dl-2-methyl-p-tyrosine | ChEMBL |
| D,l-metyrosine | ChEMBL |
| Dl-metyrosine | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| HMDB0247174 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:658-48-0 | SUBMITTER |
| Citations |
|---|