EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34NO3 |
| Net Charge | -1 |
| Average Mass | 360.518 |
| Monoisotopic Mass | 360.25442 |
| SMILES | CC(C)CCCCCCCCCC(=O)N[C@@H](Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C22H35NO3/c1-18(2)13-9-6-4-3-5-7-12-16-21(24)23-20(22(25)26)17-19-14-10-8-11-15-19/h8,10-11,14-15,18,20H,3-7,9,12-13,16-17H2,1-2H3,(H,23,24)(H,25,26)/p-1/t20-/m0/s1 |
| InChIKey | ULHFKLINEBHBJT-FQEVSTJZSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(11-methyldodecanoyl)-L-phenylalanine(1−) (CHEBI:232395) is a N-acyl-L-phenylalanine (CHEBI:77673) |
| N-(11-methyldodecanoyl)-L-phenylalanine(1−) (CHEBI:232395) is a monocarboxylic acid anion (CHEBI:35757) |
| UniProt Name | Source |
|---|---|
| N-(11-methyldodecanoyl)-L-phenylalanine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-27205 | MetaCyc |
| Citations |
|---|