EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H17F3N4O3S2 |
| Net Charge | 0 |
| Average Mass | 518.542 |
| Monoisotopic Mass | 518.06942 |
| SMILES | CN(c1ccc(C(F)(F)F)cc1)S(=O)(=O)c1ccc(C(=O)Nc2nc(-c3ccccn3)cs2)cc1 |
| InChI | InChI=1S/C23H17F3N4O3S2/c1-30(17-9-7-16(8-10-17)23(24,25)26)35(32,33)18-11-5-15(6-12-18)21(31)29-22-28-20(14-34-22)19-4-2-3-13-27-19/h2-14H,1H3,(H,28,29,31) |
| InChIKey | HSFAATUFWDDUGW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | Wnt signalling inhibitor A substance that inhibits any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SSTC3 (CHEBI:232382) has role antineoplastic agent (CHEBI:35610) |
| SSTC3 (CHEBI:232382) has role Wnt signalling inhibitor (CHEBI:78031) |
| SSTC3 (CHEBI:232382) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| SSTC3 (CHEBI:232382) is a 1,3-thiazoles (CHEBI:38418) |
| SSTC3 (CHEBI:232382) is a benzamides (CHEBI:22702) |
| SSTC3 (CHEBI:232382) is a pyridines (CHEBI:26421) |
| SSTC3 (CHEBI:232382) is a secondary carboxamide (CHEBI:140325) |
| SSTC3 (CHEBI:232382) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-{methyl[4-(trifluoromethyl)phenyl]sulfamoyl}-N-[4-(pyridin-2-yl)-1,3-thiazol-2-yl]benzamide |
| Synonyms | Source |
|---|---|
| 4-[methyl-[4-(trifluoromethyl)phenyl]sulfamoyl]-N-(4-pyridin-2-yl-1,3-thiazol-2-yl)benzamide | SUBMITTER |
| SSTC 3 | ChEBI |
| SSTC-3 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:1242422-09-8 | ChEBI |
| Citations |
|---|