EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26F2N6O |
| Net Charge | 0 |
| Average Mass | 440.498 |
| Monoisotopic Mass | 440.21362 |
| SMILES | N#Cc1ccnc(Nc2cc(C3CCN(C4COC4)CC3)cc(N3CCC(F)(F)C3)n2)c1 |
| InChI | InChI=1S/C23H26F2N6O/c24-23(25)4-8-31(15-23)22-11-18(17-2-6-30(7-3-17)19-13-32-14-19)10-21(29-22)28-20-9-16(12-26)1-5-27-20/h1,5,9-11,17,19H,2-4,6-8,13-15H2,(H,27,28,29) |
| InChIKey | RHFIAUKMKYHHFA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | inhibitor A substance that diminishes the rate of a chemical reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| GNE-3511 (CHEBI:232381) has role inhibitor (CHEBI:35222) |
| GNE-3511 (CHEBI:232381) is a aminopyridine (CHEBI:38207) |
| GNE-3511 (CHEBI:232381) is a cyanopyridine (CHEBI:23438) |
| GNE-3511 (CHEBI:232381) is a fluoropyrrolidine (CHEBI:46768) |
| GNE-3511 (CHEBI:232381) is a oxetanes (CHEBI:38784) |
| GNE-3511 (CHEBI:232381) is a piperidines (CHEBI:26151) |
| GNE-3511 (CHEBI:232381) is a secondary amino compound (CHEBI:50995) |
| GNE-3511 (CHEBI:232381) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| 2-[[6-(3,3-difluoropyrrolidin-1-yl)-4-[1-(oxetan-3-yl)piperidin-4-yl]pyridin-2-yl]amino]pyridine-4-carbonitrile |
| Synonyms | Source |
|---|---|
| GNE 3511 | ChEBI |
| GNE3511 | ChEBI |
| Citations |
|---|