EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:232379 - triflumezopyrim
| Formula | C20H13F3N4O2 |
| Net Charge | 0 |
| Average Mass | 398.344 |
| Monoisotopic Mass | 398.09906 |
| SMILES | O=c1c(-c2cccc(C(F)(F)F)c2)c([O-])[n+]2ccccc2n1Cc1cncnc1 |
| InChI | InChI=1S/C20H13F3N4O2/c21-20(22,23)15-5-3-4-14(8-15)17-18(28)26-7-2-1-6-16(26)27(19(17)29)11-13-9-24-12-25-10-13/h1-10,12H,11H2 |
| InChIKey | LHZOTJOOBRODLL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triflumezopyrim (CHEBI:232379) has role insecticide (CHEBI:24852) |
| triflumezopyrim (CHEBI:232379) has role nicotinic antagonist (CHEBI:48878) |
| triflumezopyrim (CHEBI:232379) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| triflumezopyrim (CHEBI:232379) is a pyrimidines (CHEBI:39447) |
| IUPAC Name |
|---|
| 2-oxo-1-(pyrimidin-5-ylmethyl)-3-[3-(trifluoromethyl)phenyl]-1,2-dihydropyrido[1,2-a]pyrimidin-5-ium-4-olate |
| Synonym | Source |
|---|---|
| DPX-RAB55 | PPDB |
| Manual Xrefs | Databases |
|---|---|
| 2668 | PPDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1263133-33-0 | SUBMITTER |
| Citations |
|---|