EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:232379 - triflumezopyrim
| Formula | C20H13F3N4O2 |
| Net Charge | 0 |
| Average Mass | 398.344 |
| Monoisotopic Mass | 398.09906 |
| SMILES | O=c1c(-c2cccc(C(F)(F)F)c2)c([O-])[n+]2ccccc2n1Cc1cncnc1 |
| InChI | InChI=1S/C20H13F3N4O2/c21-20(22,23)15-5-3-4-14(8-15)17-18(28)26-7-2-1-6-16(26)27(19(17)29)11-13-9-24-12-25-10-13/h1-10,12H,11H2 |
| InChIKey | LHZOTJOOBRODLL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. |
| Applications: | nicotinic antagonist An antagonist at the nicotinic cholinergic receptor. insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triflumezopyrim (CHEBI:232379) has role insecticide (CHEBI:24852) |
| triflumezopyrim (CHEBI:232379) has role nicotinic antagonist (CHEBI:48878) |
| triflumezopyrim (CHEBI:232379) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| triflumezopyrim (CHEBI:232379) is a pyrimidines (CHEBI:39447) |
| IUPAC Name |
|---|
| 2-oxo-1-(pyrimidin-5-ylmethyl)-3-[3-(trifluoromethyl)phenyl]-1,2-dihydropyrido[1,2-a]pyrimidin-5-ium-4-olate |
| Synonym | Source |
|---|---|
| DPX-RAB55 | PPDB |
| Manual Xrefs | Databases |
|---|---|
| 2668 | PPDB |
| Registry Numbers | Sources |
|---|---|
| CAS:1263133-33-0 | SUBMITTER |
| Citations |
|---|