EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H28Cl2NO3P |
| Net Charge | 0 |
| Average Mass | 408.306 |
| Monoisotopic Mass | 407.11839 |
| SMILES | C[C@H](NC[C@H](O)CP(=O)(O)CC1CCCCC1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H28Cl2NO3P/c1-13(15-7-8-17(19)18(20)9-15)21-10-16(22)12-25(23,24)11-14-5-3-2-4-6-14/h7-9,13-14,16,21-22H,2-6,10-12H2,1H3,(H,23,24)/t13-,16-/m0/s1 |
| InChIKey | JGGVBBYJRQOPPA-BBRMVZONSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. |
| Application: | GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CGP-54626 (CHEBI:232377) has role GABA antagonist (CHEBI:65259) |
| CGP-54626 (CHEBI:232377) is a dichlorobenzene (CHEBI:23697) |
| CGP-54626 (CHEBI:232377) is a secondary alcohol (CHEBI:35681) |
| CGP-54626 (CHEBI:232377) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| cyclohexylmethyl-[(2S)-3-[[(1S)-1-(3,4-dichlorophenyl)ethyl]amino]-2-hydroxypropyl]phosphinic acid |