EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H41N3O8S |
| Net Charge | 0 |
| Average Mass | 651.782 |
| Monoisotopic Mass | 651.26144 |
| SMILES | [H][C@@]1(/C(O)=N/[C@@]([H])(CCc2ccccc2)[C@]([H])(O)CN(CC(C)C)S(=O)(=O)c2ccc(OC)cc2)CN(c2cccc(C(C)=O)c2)C(=O)O1 |
| InChI | InChI=1S/C34H41N3O8S/c1-23(2)20-36(46(42,43)29-16-14-28(44-4)15-17-29)21-31(39)30(18-13-25-9-6-5-7-10-25)35-33(40)32-22-37(34(41)45-32)27-12-8-11-26(19-27)24(3)38/h5-12,14-17,19,23,30-32,39H,13,18,20-22H2,1-4H3,(H,35,40)/t30-,31+,32-/m0/s1 |
| InChIKey | NWOVALISMAROAW-QAXCHELISA-N |
| Roles Classification |
|---|
| Biological Role: | protein kinase inhibitor An EC 2.7.* (P-containing group transferase) inhibitor that interferes with the action of protein kinases. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SAR-AD81 (CHEBI:232374) has role protein kinase inhibitor (CHEBI:37699) |
| SAR-AD81 (CHEBI:232374) is a methyl ketone (CHEBI:51867) |
| SAR-AD81 (CHEBI:232374) is a monomethoxybenzene (CHEBI:25235) |
| SAR-AD81 (CHEBI:232374) is a sulfonamide (CHEBI:35358) |
| Citations |
|---|