EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H20N4O |
| Net Charge | 0 |
| Average Mass | 356.429 |
| Monoisotopic Mass | 356.16371 |
| SMILES | Nc1ccc2ncnc(NCCc3ccc(Oc4ccccc4)cc3)c2c1 |
| InChI | InChI=1S/C22H20N4O/c23-17-8-11-21-20(14-17)22(26-15-25-21)24-13-12-16-6-9-19(10-7-16)27-18-4-2-1-3-5-18/h1-11,14-15H,12-13,23H2,(H,24,25,26) |
| InChIKey | IBAKVEUZKHOWNG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. NF-kappaB inhibitor An inhibitor of NF-κB (nuclear factor κ-light-chain-enhancer of activated B cells), a protein complex involved in the transcription of DNA. EC 1.6.5.3 [NADH:ubiquinone reductase (H(+)-translocating)] inhibitor A respiratory-chain inhibitor that interferes with the action of the the enzyme NADH:ubiquinone reductase (H+-translocating), EC 1.6.5.3. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antiparasitic agent A substance used to treat or prevent parasitic infections. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| EVP4593 (CHEBI:232358) has role anti-inflammatory agent (CHEBI:67079) |
| EVP4593 (CHEBI:232358) has role antineoplastic agent (CHEBI:35610) |
| EVP4593 (CHEBI:232358) has role antiparasitic agent (CHEBI:35442) |
| EVP4593 (CHEBI:232358) has role apoptosis inducer (CHEBI:68495) |
| EVP4593 (CHEBI:232358) has role EC 1.6.5.3 [NADH:ubiquinone reductase (H+-translocating)] inhibitor (CHEBI:38503) |
| EVP4593 (CHEBI:232358) has role NF-κB inhibitor (CHEBI:73240) |
| EVP4593 (CHEBI:232358) is a aromatic ether (CHEBI:35618) |
| EVP4593 (CHEBI:232358) is a benzenes (CHEBI:22712) |
| EVP4593 (CHEBI:232358) is a primary amino compound (CHEBI:50994) |
| EVP4593 (CHEBI:232358) is a quinazolines (CHEBI:38530) |
| EVP4593 (CHEBI:232358) is a secondary amino compound (CHEBI:50995) |
| IUPAC Name |
|---|
| N4-[2-(4-phenoxyphenyl)ethyl]quinazoline-4,6-diamine |
| Synonyms | Source |
|---|---|
| 6-amino-4-(4-phenoxyphenylethylamino)quinazoline | SUBMITTER |
| QNZ | ChEBI |
| EVP-4593 | ChEBI |
| EVP 4593 | ChEBI |
| N4-(4-phenoxyphenethyl)quinazoline-4,6-diamine | ChEBI |
| N4-[2-(4-phenoxyphenyl)ethyl]-4,6-quinazolinediamine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0246942 | HMDB |
| LSM-45149 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9350957 | Reaxys |
| CAS:545380-34-5 | SUBMITTER |
| Citations |
|---|