EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H18O2S |
| Net Charge | 0 |
| Average Mass | 262.374 |
| Monoisotopic Mass | 262.10275 |
| SMILES | CCCCC#CCSc1ccccc1OC(C)=O |
| InChI | InChI=1S/C15H18O2S/c1-3-4-5-6-9-12-18-15-11-8-7-10-14(15)17-13(2)16/h7-8,10-11H,3-5,12H2,1-2H3 |
| InChIKey | GXMBHQRROXQUJS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | non-steroidal anti-inflammatory drug An anti-inflammatory drug that is not a steroid. In addition to anti-inflammatory actions, non-steroidal anti-inflammatory drugs have analgesic, antipyretic, and platelet-inhibitory actions. They act by blocking the synthesis of prostaglandins by inhibiting cyclooxygenase, which converts arachidonic acid to cyclic endoperoxides, precursors of prostaglandins. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2-hept-2-ynylsulfanylphenyl) acetate (CHEBI:232352) has role non-steroidal anti-inflammatory drug (CHEBI:35475) |
| (2-hept-2-ynylsulfanylphenyl) acetate (CHEBI:232352) is a acetylenic compound (CHEBI:73474) |
| (2-hept-2-ynylsulfanylphenyl) acetate (CHEBI:232352) is a aryl sulfide (CHEBI:35683) |
| (2-hept-2-ynylsulfanylphenyl) acetate (CHEBI:232352) is a phenyl acetates (CHEBI:140310) |
| IUPAC Name |
|---|
| 2-(hept-2-yn-1-ylsulfanyl)phenyl acetate |
| Synonyms | Source |
|---|---|
| 2-[(hept-2-yn-1-yl)sulfanyl]phenyl acetate | IUPAC |
| acetic acid 2-hept-2-ynylsulfanyl-phenyl ester | ChEBI |
| APHS | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:209125-28-0 | SUBMITTER |
| Citations |
|---|