EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O7P2 |
| Net Charge | -3 |
| Average Mass | 447.425 |
| Monoisotopic Mass | 447.17180 |
| SMILES | C=C(C)C12CCCC1C(C)(CC/C(C)=C/COP(=O)([O-])OP(=O)([O-])[O-])C(C)CC2 |
| InChI | InChI=1S/C20H36O7P2/c1-15(2)20-11-6-7-18(20)19(5,17(4)9-13-20)12-8-16(3)10-14-26-29(24,25)27-28(21,22)23/h10,17-18H,1,6-9,11-14H2,2-5H3,(H,24,25)(H2,21,22,23)/p-3/b16-10+ |
| InChIKey | QAQWSQUHPLKXKY-MHWRWJLKSA-K |
| Roles Classification |
|---|
| Biological Role: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| multidienyl diphosphate(3-) (CHEBI:232343) has role fungal metabolite (CHEBI:76946) |
| multidienyl diphosphate(3-) (CHEBI:232343) is a diterpene (CHEBI:35190) |
| multidienyl diphosphate(3-) (CHEBI:232343) is a diterpenyl phosphate (CHEBI:36772) |
| Citations |
|---|