EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12FN3O3S |
| Net Charge | 0 |
| Average Mass | 309.322 |
| Monoisotopic Mass | 309.05834 |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C13H12FN3O3S/c14-9-1-3-10(4-2-9)16-13(18)17-11-5-7-12(8-6-11)21(15,19)20/h1-8H,(H2,15,19,20)(H2,16,17,18) |
| InChIKey | YJQZNWPYLCNRLP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 4.2.1.1 (carbonic anhydrase) inhibitor An EC 4.2.1.* (hydro-lyases) inhibitor that interferes with the action of carbonic anhydrase (EC 4.2.1.1). Such compounds reduce the secretion of H+ ions by the proximal kidney tubule. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SLC-0111 (CHEBI:232342) has role antineoplastic agent (CHEBI:35610) |
| SLC-0111 (CHEBI:232342) has role EC 4.2.1.1 (carbonic anhydrase) inhibitor (CHEBI:23018) |
| SLC-0111 (CHEBI:232342) is a monofluorobenzenes (CHEBI:83575) |
| SLC-0111 (CHEBI:232342) is a phenylureas (CHEBI:134043) |
| SLC-0111 (CHEBI:232342) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| 4-{[(4-fluorophenyl)carbamoyl]amino}benzenesulfonamide |
| Synonyms | Source |
|---|---|
| 4-{[(4-fluorophenyl)carbamoyl]amino}benzene-1-sulfonamide | IUPAC |
| U-104 | DrugBank |
| U104 | DrugBank |
| SLC0111 | DrugBank |
| SLC 0111 | ChEBI |
| U 104 | ChEBI |
| Citations |
|---|