EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H50N4O2.Br.Br |
| Net Charge | 0 |
| Average Mass | 706.608 |
| Monoisotopic Mass | 704.23005 |
| SMILES | CC[N+](CC)(CCCNC1=CC(=O)C(NCCC[N+](CC)(CC)Cc2ccccc2)=CC1=O)Cc1ccccc1.[Br-].[Br-] |
| InChI | InChI=1S/C34H48N4O2.2BrH/c1-5-37(6-2,27-29-17-11-9-12-18-29)23-15-21-35-31-25-34(40)32(26-33(31)39)36-22-16-24-38(7-3,8-4)28-30-19-13-10-14-20-30;;/h9-14,17-20,25-26H,5-8,15-16,21-24,27-28H2,1-4H3;2*1H |
| InChIKey | DVQZHWAYOLXTHE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| Application: | cholinergic antagonist Any drug that binds to but does not activate cholinergic receptors, thereby blocking the actions of acetylcholine or cholinergic agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| benzoquinonium dibromide (CHEBI:232337) has role cholinergic antagonist (CHEBI:48873) |
| benzoquinonium dibromide (CHEBI:232337) is a organic bromide salt (CHEBI:48369) |
| benzoquinonium dibromide (CHEBI:232337) is a quaternary ammonium salt (CHEBI:35273) |
| IUPAC Name |
|---|
| benzyl-[3-[[4-[3-[benzyl(diethyl)azaniumyl]propylamino]-3,6-dioxocyclohexa-1,4-dien-1-yl]amino]propyl]-diethylazanium;dibromide |
| Citations |
|---|