EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H37N3O6 |
| Net Charge | 0 |
| Average Mass | 583.685 |
| Monoisotopic Mass | 583.26824 |
| SMILES | O=C(/C=C/c1ccc(O)cc1)NCCCCN(CCCNC(=O)/C=C/c1ccc(O)cc1)C(=O)/C=C/c1ccc(O)cc1 |
| InChI | InChI=1S/C34H37N3O6/c38-29-13-4-26(5-14-29)10-19-32(41)35-22-1-2-24-37(34(43)21-12-28-8-17-31(40)18-9-28)25-3-23-36-33(42)20-11-27-6-15-30(39)16-7-27/h4-21,38-40H,1-3,22-25H2,(H,35,41)(H,36,42)/b19-10+,20-11+,21-12+ |
| InChIKey | PFDVWJCSCYDRMZ-AUCPOXKISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Carthamus tinctorius (ncbitaxon:4222) | - | PubMed (24055753) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N1,N5,N10-(E)-tri-p-coumaroylspermidine (CHEBI:232336) has functional parent trans-4-coumaric acid (CHEBI:32374) |
| N1,N5,N10-(E)-tri-p-coumaroylspermidine (CHEBI:232336) has role plant metabolite (CHEBI:76924) |
| N1,N5,N10-(E)-tri-p-coumaroylspermidine (CHEBI:232336) is a N1,N5,N10-tri-p-coumaroyl spermidine (CHEBI:61514) |
| IUPAC Name |
|---|
| (2E)-3-(4-hydroxyphenyl)-N-(4-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino}butyl)-N-(3-{[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]amino}propyl)prop-2-enamide |
| Synonyms | Source |
|---|---|
| (2E)-3-(4-hydroxyphenyl)-N-[4-[[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]amino]butyl]-N-[3-[[(2E)-3-(4-hydroxyphenyl)-1-oxo-2-propen-1-yl]amino]propyl]-2-propenamide | ChEBI |
| N1,N5,N10-(E)-tri-p-coumaroylspermidine | ChEBI |
| N1,N5,N10-tri-p-(E)-coumaroylspermidine | ChEBI |
| UniProt Name | Source |
|---|---|
| N1,N5,N10-tris[(E)-p-coumaroyl]spermidine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-12212 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4240971 | Reaxys |
| CAS:131086-78-7 | ChEBI |
| Citations |
|---|