EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24 |
| Net Charge | 0 |
| Average Mass | 204.357 |
| Monoisotopic Mass | 204.18780 |
| SMILES | CC1=C[C@@]23CCC[C@@H](C)[C@]2(C)C[C@@H]1CC3 |
| InChI | InChI=1S/C15H24/c1-11-9-15-7-4-5-12(2)14(15,3)10-13(11)6-8-15/h9,12-13H,4-8,10H2,1-3H3/t12-,13+,14+,15+/m1/s1 |
| InChIKey | FXUKDXOVALSRSU-QPSCCSFWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Radula lindenbergiana (ncbitaxon:697108) | - | PubMed (38372483) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4,5-diepi-isoishwarane (CHEBI:232333) has role plant metabolite (CHEBI:76924) |
| 4,5-diepi-isoishwarane (CHEBI:232333) is a sesquiterpene (CHEBI:35189) |
| Citations |
|---|