EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H37N3O9 |
| Net Charge | 0 |
| Average Mass | 631.682 |
| Monoisotopic Mass | 631.25298 |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)NCCCCN(CCCNC(=O)/C=C/c1ccc(O)c(O)c1)C(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C34H37N3O9/c38-26-10-4-23(20-29(26)41)7-13-32(44)35-16-1-2-18-37(34(46)15-9-25-6-12-28(40)31(43)22-25)19-3-17-36-33(45)14-8-24-5-11-27(39)30(42)21-24/h4-15,20-22,38-43H,1-3,16-19H2,(H,35,44)(H,36,45)/b13-7+,14-8+,15-9+ |
| InChIKey | ZKNHGZHOGBDPIA-ZOWBABNGSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N1,N5,N10-tris-(E)-caffeoyl spermidine (CHEBI:232324) has functional parent trans-caffeic acid (CHEBI:16433) |
| N1,N5,N10-tris-(E)-caffeoyl spermidine (CHEBI:232324) is a N1,N5,N10-tricaffeoyl spermidine (CHEBI:81478) |
| IUPAC Name |
|---|
| (2E)-3-(3,4-dihydroxyphenyl)-N-(4-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino}butyl)-N-(3-{[(2E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]amino}propyl)prop-2-enamide |
| UniProt Name | Source |
|---|---|
| N1,N5,N10-tris[(E)-caffeoyl]spermidine | UniProt |