EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H9N5O |
| Net Charge | 0 |
| Average Mass | 275.271 |
| Monoisotopic Mass | 275.08071 |
| SMILES | CCO/N=C1\c2ccccc2-c2nc(C#N)c(C#N)nc21 |
| InChI | InChI=1S/C15H9N5O/c1-2-21-20-14-10-6-4-3-5-9(10)13-15(14)19-12(8-17)11(7-16)18-13/h3-6H,2H2,1H3/b20-14+ |
| InChIKey | VKVAJBRQGBRHIK-XSFVSMFZSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 3.4.19.* (omega-peptidase) inhibitor Any EC 3.4.* (hydrolases acting on peptide bond) inhibitor that interferes with the action of any omega-peptidase (EC 3.4.19.*). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DUB-IN-2 (CHEBI:232317) has role EC 3.4.19.* (omega-peptidase) inhibitor (CHEBI:77705) |
| DUB-IN-2 (CHEBI:232317) is a dinitrile (CHEBI:51308) |
| Synonym | Source |
|---|---|
| deubiquitinase inhibitor 2 | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:924296-19-5 | SUBMITTER |