EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H14N4O6S |
| Net Charge | 0 |
| Average Mass | 474.454 |
| Monoisotopic Mass | 474.06341 |
| SMILES | O=C1C(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)=C(n2cnc3ccccc32)C(=O)c2ccccc21 |
| InChI | InChI=1S/C23H14N4O6S/c28-22-16-5-1-2-6-17(16)23(29)21(26-13-24-18-7-3-4-8-19(18)26)20(22)25-34(32,33)15-11-9-14(10-12-15)27(30)31/h1-13,25H |
| InChIKey | FSAINSJUQREKEK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). |
| Application: | geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AUTEN-67 (CHEBI:232158) has role autophagy inducer (CHEBI:138880) |
| AUTEN-67 (CHEBI:232158) has role geroprotector (CHEBI:176497) |
| AUTEN-67 (CHEBI:232158) is a organic molecular entity (CHEBI:50860) |
| IUPAC Name |
|---|
| N-[3-(benzimidazol-1-yl)-1,4-dioxonaphthalen-2-yl]-4-nitrobenzenesulfonamide |
| Manual Xrefs | Databases |
|---|---|
| https://en.wikipedia.org/wiki/AUTEN-67 | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:1783800-77-0 | SUBMITTER |
| Citations |
|---|