EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10N6 |
| Net Charge | 0 |
| Average Mass | 190.210 |
| Monoisotopic Mass | 190.09669 |
| SMILES | N#Cc1c(N)nc(NC2CC2)nc1N |
| InChI | InChI=1S/C8H10N6/c9-3-5-6(10)13-8(14-7(5)11)12-4-1-2-4/h4H,1-2H2,(H5,10,11,12,13,14) |
| InChIKey | PKTIFYGCWCQRSX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | carcinogenic agent A role played by a chemical compound which is known to induce a process of carcinogenesis by corrupting normal cellular pathways, leading to the acquistion of tumoral capabilities. insect growth regulator A growth regulator that inhibits the life cycle of an insect. |
| Applications: | insecticide Strictly, a substance intended to kill members of the class Insecta. In common usage, any substance used for preventing, destroying, repelling or controlling insects. antiparasitic agent A substance used to treat or prevent parasitic infections. insect growth regulator A growth regulator that inhibits the life cycle of an insect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dicyclanil (CHEBI:232105) has role antiparasitic agent (CHEBI:35442) |
| dicyclanil (CHEBI:232105) has role carcinogenic agent (CHEBI:50903) |
| dicyclanil (CHEBI:232105) has role insect growth regulator (CHEBI:24851) |
| dicyclanil (CHEBI:232105) has role insecticide (CHEBI:24852) |
| dicyclanil (CHEBI:232105) is a aminopyrimidine (CHEBI:38338) |
| dicyclanil (CHEBI:232105) is a cyclopropanes (CHEBI:51454) |
| dicyclanil (CHEBI:232105) is a nitrile (CHEBI:18379) |
| IUPAC Name |
|---|
| 4,6-diamino-2-(cyclopropylamino)pyrimidine-5-carbonitrile |
| Synonyms | Source |
|---|---|
| 2-(cyclopropylamino)-4,6-diamino-5-cyanopyrimidine | ChEBI |
| 4,6-diamino-2-(cyclopropylamino)-5-pyrimidinecarbonitrile | ChEBI |
| CGA 183893 | VSDB |
| CGA-183893 | ChEBI |
| huanchongjing | Alan Wood's Pesticides |
| Brand Name | Source |
|---|---|
| CLiKZiN | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1033 | VSDB |
| dicyclanil | Alan Wood's Pesticides |
| WO2009118312 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:112636-83-6 | SUBMITTER |
| Citations |
|---|