EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O8 |
| Net Charge | 0 |
| Average Mass | 496.641 |
| Monoisotopic Mass | 496.30362 |
| SMILES | [H][C@]1([C@@](C)(O)[C@H](O)CCC(C)C)CC[C@@]2(O)C3=CC(=O)[C@]4(O)C[C@@H](O)[C@@H](O)C[C@]4(C)[C@@]3([H])[C@H](O)C[C@]12C |
| InChI | InChI=1S/C27H44O8/c1-14(2)6-7-20(31)25(5,33)19-8-9-26(34)15-10-21(32)27(35)13-17(29)16(28)11-24(27,4)22(15)18(30)12-23(19,26)3/h10,14,16-20,22,28-31,33-35H,6-9,11-13H2,1-5H3/t16-,17+,18+,19-,20+,22+,23+,24+,25+,26+,27+/m0/s1 |
| InChIKey | LRJUYAVTHIEHAI-LHBNDURVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dioscorea dumetorum (ncbitaxon:167584) | - | PubMed (38945493) | |
| Ipomoea calonyction (ncbitaxon:4119) | - | DOI (10.1039/C3972001060B) |
| Roles Classification |
|---|
| Biological Roles: | protein synthesis inhibitor A compound, usually an anti-bacterial agent or a toxin, which inhibits the synthesis of a protein. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| muristerone A (CHEBI:232104) has parent hydride 5β-cholestane (CHEBI:35517) |
| muristerone A (CHEBI:232104) has role plant metabolite (CHEBI:76924) |
| muristerone A (CHEBI:232104) has role protein synthesis inhibitor (CHEBI:48001) |
| muristerone A (CHEBI:232104) is a 11α-hydroxy steroid (CHEBI:19129) |
| muristerone A (CHEBI:232104) is a 14α-hydroxy steroid (CHEBI:36861) |
| muristerone A (CHEBI:232104) is a 20-hydroxy steroid (CHEBI:36854) |
| muristerone A (CHEBI:232104) is a 22-hydroxy steroid (CHEBI:36863) |
| muristerone A (CHEBI:232104) is a 2β-hydroxy steroid (CHEBI:36859) |
| muristerone A (CHEBI:232104) is a 3β-sterol (CHEBI:35348) |
| muristerone A (CHEBI:232104) is a 5β-hydroxy steroid (CHEBI:38195) |
| muristerone A (CHEBI:232104) is a 6-oxo steroid (CHEBI:36883) |
| muristerone A (CHEBI:232104) is a phytoecdysteroid (CHEBI:26118) |
| IUPAC Name |
|---|
| (22R)-2β,3β,5,11α,14,20,22-heptahydroxy-5β-cholest-7-en-6-one |
| Synonyms | Source |
|---|---|
| 2β,3β,5β,11α,14α,20R,22R-hepta-hydroxy-cholest-7-en-6-one | LIPID MAPS |
| 2β,3β,5β,11α,14α,20R,22R-hepta-hydroxycholest-7-en-6-one | ChEBI |
| 2β,3β,5β,11α,14α,20R,22R-heptahydroxycholest-7-en-6-one | ChEBI |
| MurA | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:38778-30-2 | SUBMITTER |
| Citations |
|---|