EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6N4 |
| Net Charge | 0 |
| Average Mass | 134.142 |
| Monoisotopic Mass | 134.05925 |
| SMILES | Nn1nnc2ccccc21 |
| InChI | InChI=1S/C6H6N4/c7-10-6-4-2-1-3-5(6)8-9-10/h1-4H,7H2 |
| InChIKey | JCXKHYLLVKZPKE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. EC 1.4.3.4 (monoamine oxidase) inhibitor An EC 1.4.3.* (oxidoreductase acting on donor CH-NH2 group, oxygen as acceptor) inhibitor that interferes with the action of monoamine oxidase (EC 1.4.3.4). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-aminobenzotriazole (CHEBI:232102) has role EC 1.4.3.4 (monoamine oxidase) inhibitor (CHEBI:38623) |
| 1-aminobenzotriazole (CHEBI:232102) has role P450 inhibitor (CHEBI:50183) |
| 1-aminobenzotriazole (CHEBI:232102) is a benzotriazoles (CHEBI:48912) |
| 1-aminobenzotriazole (CHEBI:232102) is a hydrazines (CHEBI:24631) |
| IUPAC Name |
|---|
| 1H-benzotriazol-1-amine |
| Synonyms | Source |
|---|---|
| 1-ABT | ChEBI |
| 1-ABTZ | HMDB |
| 1-amino-1,2,3-benzotriazole | ChEBI |
| 1-benzotriazolamine | ChEBI |
| 1-benzotriazolylamine | ChEBI |
| 1H-1,2,3-benzotriazol-1-amine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0243821 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:607843 | Reaxys |
| CAS:1614-12-6 | SUBMITTER |
| Citations |
|---|