EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H11N |
| Net Charge | 0 |
| Average Mass | 169.227 |
| Monoisotopic Mass | 169.08915 |
| SMILES | Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H11N/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9H,13H2 |
| InChIKey | TWBPWBPGNQWFSJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-aminobiphenyl (CHEBI:232095) has role apoptosis inducer (CHEBI:68495) |
| 2-aminobiphenyl (CHEBI:232095) is a benzenes (CHEBI:22712) |
| 2-aminobiphenyl (CHEBI:232095) is a biphenyls (CHEBI:22888) |
| 2-aminobiphenyl (CHEBI:232095) is a primary amino compound (CHEBI:50994) |
| 2-aminobiphenyl (CHEBI:232095) is a substituted aniline (CHEBI:48975) |
| IUPAC Name |
|---|
| [biphenyl]-2-amine |
| Synonyms | Source |
|---|---|
| [1,1'-biphenyl]-2-amine | IUPAC |
| 2-ABP | ChEBI |
| 2-amino-1,1-biphenyl | ChEBI |
| 2-amino-1,1'-biphenyl | NIST Chemistry WebBook |
| 2-aminodiphenyl | NIST Chemistry WebBook |
| 2-biphenylamine | NIST Chemistry WebBook |
| Manual Xrefs | Databases |
|---|---|
| 2-Aminobiphenyl | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:471874 | Reaxys |
| CAS:90-41-5 | NIST Chemistry WebBook |
| Citations |
|---|