EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17N5O |
| Net Charge | 0 |
| Average Mass | 247.302 |
| Monoisotopic Mass | 247.14331 |
| SMILES | Cn1c(CCCNC(=N)N)cn2cccc2c1=O |
| InChI | InChI=1S/C12H17N5O/c1-16-9(4-2-6-15-12(13)14)8-17-7-3-5-10(17)11(16)18/h3,5,7-8H,2,4,6H2,1H3,(H4,13,14,15) |
| InChIKey | GQWWGRUJOCIUKI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Epichloe festucae var. lolii (ncbitaxon:73839) | - | PubMed (24263837) | Species also known as Acremonium lolii. |
| Roles Classification |
|---|
| Biological Roles: | fungal metabolite Any eukaryotic metabolite produced during a metabolic reaction in fungi, the kingdom that includes microorganisms such as the yeasts and moulds. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antifeedant A substance that prevents pests from feeding. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| peramine (CHEBI:232090) has role antifeedant (CHEBI:22583) |
| peramine (CHEBI:232090) has role fungal metabolite (CHEBI:76946) |
| peramine (CHEBI:232090) is a alkaloid (CHEBI:22315) |
| peramine (CHEBI:232090) is a guanidines (CHEBI:24436) |
| peramine (CHEBI:232090) is a pyrrolopyrazine (CHEBI:48337) |
| peramine (CHEBI:232090) is conjugate base of peramine(1+) (CHEBI:232088) |
| Incoming Relation(s) |
| peramine(1+) (CHEBI:232088) is conjugate acid of peramine (CHEBI:232090) |
| IUPAC Name |
|---|
| 1-[3-(2-methyl-1-oxo-1,2-dihydropyrrolo[1,2-a]pyrazin-3-yl)propyl]guanidine |
| Synonym | Source |
|---|---|
| N-[3-(2-methyl-1-oxo-1,2-dihydropyrrolo[1,2-a]pyrazin-3-yl)propyl]guanidine | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C00024793 | KNApSAcK |
| HMDB0256303 | HMDB |
| WO2006132555 | Patent |
| Registry Numbers | Sources |
|---|---|
| CAS:102482-94-0 | KNApSAcK |
| Citations |
|---|