EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N2O5 |
| Net Charge | 0 |
| Average Mass | 226.188 |
| Monoisotopic Mass | 226.05897 |
| SMILES | [NH3+][C@@H](Cc1ccc(O)c([N+](=O)[O-])c1)C(=O)[O-] |
| InChI | InChI=1S/C9H10N2O5/c10-6(9(13)14)3-5-1-2-8(12)7(4-5)11(15)16/h1-2,4,6,12H,3,10H2,(H,13,14)/t6-/m0/s1 |
| InChIKey | FBTSQILOGYXGMD-LURJTMIESA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-nitro-L-tyrosine zwitterion (CHEBI:232064) is a amino-acid zwitterion (CHEBI:35238) |
| 3-nitro-L-tyrosine zwitterion (CHEBI:232064) is tautomer of 3-nitro-L-tyrosine (CHEBI:44454) |
| Incoming Relation(s) |
| 3-nitro-L-tyrosine (CHEBI:44454) is tautomer of 3-nitro-L-tyrosine zwitterion (CHEBI:232064) |
| UniProt Name | Source |
|---|---|
| 3-nitro-L-tyrosine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-25868 | MetaCyc |
| Citations |
|---|