EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23NO2 |
| Net Charge | 0 |
| Average Mass | 309.409 |
| Monoisotopic Mass | 309.17288 |
| SMILES | O=C(O)Cc1cnc2ccc(C34CC5CC(CC(C5)C3)C4)cc12 |
| InChI | InChI=1S/C20H23NO2/c22-19(23)6-15-11-21-18-2-1-16(7-17(15)18)20-8-12-3-13(9-20)5-14(4-12)10-20/h1-2,7,11-14,21H,3-6,8-10H2,(H,22,23) |
| InChIKey | YVLXUUNCRVEHPG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | synthetic auxin A synthetic compound exhibiting auxin activity. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-adamantyl-IAA (CHEBI:232059) has role synthetic auxin (CHEBI:26841) |
| 5-adamantyl-IAA (CHEBI:232059) is a adamantanes (CHEBI:51339) |
| 5-adamantyl-IAA (CHEBI:232059) is a indole-3-acetic acids (CHEBI:24803) |
| 5-adamantyl-IAA (CHEBI:232059) is a monocarboxylic acid (CHEBI:25384) |
| IUPAC Name |
|---|
| [5-(adamantan-1-yl)-1H-indol-3-yl]acetic acid |
| Synonyms | Source |
|---|---|
| 2-[5-(1-adamantyl)-1H-indol-3-yl]acetic acid | SUBMITTER |
| 2-(5-(adamantan-1-yl)-1H-indol-3-yl)acetic acid | SUBMITTER |
| 2-[5-(adamantan-1-yl)-1H-indol-3-yl]acetic acid | ChEBI |
| [5-(tricyclo[3.3.1.13,7]decan-1-yl)-1H-indol-3-yl]acetic acid | IUPAC |
| Registry Numbers | Sources |
|---|---|
| CAS:2244426-40-0 | SUBMITTER |
| Citations |
|---|