EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30N6O2S |
| Net Charge | 0 |
| Average Mass | 442.589 |
| Monoisotopic Mass | 442.21510 |
| SMILES | CN(C)c1cc2c(cc1Sc1nc3c(N)nccc3n1CCNCC(C)(C)C)OCO2 |
| InChI | InChI=1S/C22H30N6O2S/c1-22(2,3)12-24-8-9-28-14-6-7-25-20(23)19(14)26-21(28)31-18-11-17-16(29-13-30-17)10-15(18)27(4)5/h6-7,10-11,24H,8-9,12-13H2,1-5H3,(H2,23,25) |
| InChIKey | RVJIQAYFTOPTKK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Applications: | antipsoriatic A drug used to treat psoriasis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| RGRN-305 (CHEBI:232048) has role antineoplastic agent (CHEBI:35610) |
| RGRN-305 (CHEBI:232048) has role antipsoriatic (CHEBI:50748) |
| RGRN-305 (CHEBI:232048) is a organic molecular entity (CHEBI:50860) |
| Synonyms | Source |
|---|---|
| cudc-305 | ChEMBL |
| CUDC-305 | SUBMITTER |
| Cudc305 (hsp90 inhibitor) | ChEMBL |
| Debio 0932 | SUBMITTER |
| DEBIO-0932 | ChEMBL |
| HSP90 Inhibitor | SUBMITTER |
| Registry Numbers | Sources |
|---|---|
| CAS:1061318-81-7 | SUBMITTER |
| Citations |
|---|